C15H21NOS — CID 110865038
N-ethyl-N-(3-methylphenyl)thiane-3-carboxamide (PubChem CID 110865038) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is N-ethyl-N-(3-methylphenyl)thiane-3-carboxamide.
| Compound Name | N-ethyl-N-(3-methylphenyl)thiane-3-carboxamide |
|---|---|
| PubChem CID | 110865038 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-ethyl-N-(3-methylphenyl)thiane-3-carboxamide |
| SMILES | CCN(C(=O)C1CCCSC1)c1cccc(C)c1 |
| InChI | InChI=1S/C15H21NOS/c1-3-16(14-8-4-6-12(2)10-14)15(17)13-7-5-9-18-11-13/h4,6,8,10,13H,3,5,7,9,11H2,1-2H3 |
| InChIKey | QDZOQQXBJYJFRD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |