C13H11BrN2O3 — CID 110866599
N-[(4-bromo-2-methylphenyl)carbamoyl]furan-2-carboxamide (PubChem CID 110866599) has the molecular formula C13H11BrN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is N-[(4-bromo-2-methylphenyl)carbamoyl]furan-2-carboxamide.
| Compound Name | N-[(4-bromo-2-methylphenyl)carbamoyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110866599 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N-[(4-bromo-2-methylphenyl)carbamoyl]furan-2-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H11BrN2O3/c1-8-7-9(14)4-5-10(8)15-13(18)16-12(17)11-3-2-6-19-11/h2-7H,1H3,(H2,15,16,17,18) |
| InChIKey | CQMBNECUBICTTI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |