C12H9ClN2O3 — CID 110866393
N-[(2-chlorophenyl)carbamoyl]furan-2-carboxamide (PubChem CID 110866393) has the molecular formula C12H9ClN2O3 and a molecular weight of 264.67 g/mol. Its IUPAC name is N-[(2-chlorophenyl)carbamoyl]furan-2-carboxamide.
| Compound Name | N-[(2-chlorophenyl)carbamoyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110866393 |
| Molecular Formula | C12H9ClN2O3 |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | N-[(2-chlorophenyl)carbamoyl]furan-2-carboxamide |
| SMILES | O=C(NC(=O)c1ccco1)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H9ClN2O3/c13-8-4-1-2-5-9(8)14-12(17)15-11(16)10-6-3-7-18-10/h1-7H,(H2,14,15,16,17) |
| InChIKey | FYAYTMRHQZDNEY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |