C15H10F3N3O2 — CID 110867304
5-amino-6-methyl-3-(2,3,4-trifluorobenzoyl)-1H-benzimidazol-2-one (PubChem CID 110867304) has the molecular formula C15H10F3N3O2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 5-amino-6-methyl-3-(2,3,4-trifluorobenzoyl)-1H-benzimidazol-2-one.
| Compound Name | 5-amino-6-methyl-3-(2,3,4-trifluorobenzoyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 110867304 |
| Molecular Formula | C15H10F3N3O2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-amino-6-methyl-3-(2,3,4-trifluorobenzoyl)-1H-benzimidazol-2-one |
| SMILES | Cc1cc2[nH]c(=O)n(C(=O)c3ccc(F)c(F)c3F)c2cc1N |
| InChI | InChI=1S/C15H10F3N3O2/c1-6-4-10-11(5-9(6)19)21(15(23)20-10)14(22)7-2-3-8(16)13(18)12(7)17/h2-5H,19H2,1H3,(H,20,23) |
| InChIKey | LFXNGRCHGLEWRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|