C15H13ClN4O2 — CID 110874390
5-amino-N-(4-chlorophenyl)-6-methyl-2-oxo-3H-benzimidazole-1-carboxamide (PubChem CID 110874390) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is 5-amino-N-(4-chlorophenyl)-6-methyl-2-oxo-3H-benzimidazole-1-carboxamide.
| Compound Name | 5-amino-N-(4-chlorophenyl)-6-methyl-2-oxo-3H-benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 110874390 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-amino-N-(4-chlorophenyl)-6-methyl-2-oxo-3H-benzimidazole-1-carboxamide |
| SMILES | Cc1cc2c(cc1N)[nH]c(=O)n2C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN4O2/c1-8-6-13-12(7-11(8)17)19-15(22)20(13)14(21)18-10-4-2-9(16)3-5-10/h2-7H,17H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ZNKXQYUORJGDEJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|