C23H25ClN4O5 — CID 59017623
diethyl 2-(4-chloroanilino)-3-[(1-ethyl-2-oxo-3H-benzimidazol-5-yl)amino]but-2-enedioate (PubChem CID 59017623) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is diethyl 2-(4-chloroanilino)-3-[(1-ethyl-2-oxo-3H-benzimidazol-5-yl)amino]but-2-enedioate.
| Compound Name | diethyl 2-(4-chloroanilino)-3-[(1-ethyl-2-oxo-3H-benzimidazol-5-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 59017623 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | diethyl 2-(4-chloroanilino)-3-[(1-ethyl-2-oxo-3H-benzimidazol-5-yl)amino]but-2-enedioate |
| SMILES | CCOC(=O)C(Nc1ccc(Cl)cc1)=C(Nc1ccc2c(c1)[nH]c(=O)n2CC)C(=O)OCC |
| InChI | InChI=1S/C23H25ClN4O5/c1-4-28-18-12-11-16(13-17(18)27-23(28)31)26-20(22(30)33-6-3)19(21(29)32-5-2)25-15-9-7-14(24)8-10-15/h7-13,25-26H,4-6H2,1-3H3,(H,27,31) |
| InChIKey | XXOPDXHDWZVKPE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|