C19H21Cl3N4O2 — CID 142068065
N-[4-(butylaminomethyl)phenyl]-5,6-dichloro-2-oxo-3H-benzimidazole-1-carboxamide;hydrochloride (PubChem CID 142068065) has the molecular formula C19H21Cl3N4O2 and a molecular weight of 443.76 g/mol. Its IUPAC name is N-[4-(butylaminomethyl)phenyl]-5,6-dichloro-2-oxo-3H-benzimidazole-1-carboxamide;hydrochloride.
| Compound Name | N-[4-(butylaminomethyl)phenyl]-5,6-dichloro-2-oxo-3H-benzimidazole-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142068065 |
| Molecular Formula | C19H21Cl3N4O2 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | N-[4-(butylaminomethyl)phenyl]-5,6-dichloro-2-oxo-3H-benzimidazole-1-carboxamide;hydrochloride |
| SMILES | CCCCNCc1ccc(NC(=O)n2c(=O)[nH]c3cc(Cl)c(Cl)cc32)cc1.Cl |
| InChI | InChI=1S/C19H20Cl2N4O2.ClH/c1-2-3-8-22-11-12-4-6-13(7-5-12)23-18(26)25-17-10-15(21)14(20)9-16(17)24-19(25)27;/h4-7,9-10,22H,2-3,8,11H2,1H3,(H,23,26)(H,24,27);1H |
| InChIKey | OTZBPIXLVDYWJF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|