C25H38N4O2 — CID 142169951
6-[2-(diethylamino)ethyl]-N-(3-methylphenyl)-2-oxo-3H-benzimidazole-1-carboxamide;ethane (PubChem CID 142169951) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethyl]-N-(3-methylphenyl)-2-oxo-3H-benzimidazole-1-carboxamide;ethane.
| Compound Name | 6-[2-(diethylamino)ethyl]-N-(3-methylphenyl)-2-oxo-3H-benzimidazole-1-carboxamide;ethane |
|---|---|
| PubChem CID | 142169951 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 6-[2-(diethylamino)ethyl]-N-(3-methylphenyl)-2-oxo-3H-benzimidazole-1-carboxamide;ethane |
| SMILES | CC.CC.CCN(CC)CCc1ccc2[nH]c(=O)n(C(=O)Nc3cccc(C)c3)c2c1 |
| InChI | InChI=1S/C21H26N4O2.2C2H6/c1-4-24(5-2)12-11-16-9-10-18-19(14-16)25(21(27)23-18)20(26)22-17-8-6-7-15(3)13-17;2*1-2/h6-10,13-14H,4-5,11-12H2,1-3H3,(H,22,26)(H,23,27);2*1-2H3 |
| InChIKey | IIVLTMGCARXJSW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |