C10H11N3O3S — CID 110867998
1-(4-methoxyphenyl)sulfonylpyrazol-3-amine (PubChem CID 110867998) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonylpyrazol-3-amine.
| Compound Name | 1-(4-methoxyphenyl)sulfonylpyrazol-3-amine |
|---|---|
| PubChem CID | 110867998 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonylpyrazol-3-amine |
| SMILES | COc1ccc(S(=O)(=O)n2ccc(N)n2)cc1 |
| InChI | InChI=1S/C10H11N3O3S/c1-16-8-2-4-9(5-3-8)17(14,15)13-7-6-10(11)12-13/h2-7H,1H3,(H2,11,12) |
| InChIKey | OIBYHCLXEAMTDO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |