About 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea
3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea (PubChem CID 110869161) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea |
| PubChem CID | 110869161 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea |
| SMILES | Cc1nc2cc(NC(=O)N(C)C)ccc2n1C |
| InChI | InChI=1S/C12H16N4O/c1-8-13-10-7-9(14-12(17)15(2)3)5-6-11(10)16(8)4/h5-7H,1-4H3,(H,14,17) |
| InChIKey | OVXHXHLAKBQXQZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea?
The IUPAC name of 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea (CID 110869161) is 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea.
What is the SMILES notation for 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea?
The canonical SMILES for 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea is Cc1nc2cc(NC(=O)N(C)C)ccc2n1C.
What is the InChIKey of 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea?
The InChIKey is OVXHXHLAKBQXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-8-13-10-7-9(14-12(17)15(2)3)5-6-11(10)16(8)4/h5-7H,1-4H3,(H,14,17).
What are the key properties of 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea?
3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea has a molecular weight of 232.29 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dimethylbenzimidazol-5-yl)-1,1-dimethylurea is sourced from PubChem (CID 110869161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).