About 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid
3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid (PubChem CID 115136437) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid |
| PubChem CID | 115136437 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid |
| SMILES | Cc1nc2cc(NCC(C)(C)C(=O)O)ccc2n1C |
| InChI | InChI=1S/C14H19N3O2/c1-9-16-11-7-10(5-6-12(11)17(9)4)15-8-14(2,3)13(18)19/h5-7,15H,8H2,1-4H3,(H,18,19) |
| InChIKey | PTICKLKVACIFNF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid (CID 115136437) is 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid is Cc1nc2cc(NCC(C)(C)C(=O)O)ccc2n1C.
What is the InChIKey of 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is PTICKLKVACIFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-9-16-11-7-10(5-6-12(11)17(9)4)15-8-14(2,3)13(18)19/h5-7,15H,8H2,1-4H3,(H,18,19).
What are the key properties of 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid?
3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 261.32 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,2-dimethylbenzimidazol-5-yl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 115136437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).