About 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine
1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine (PubChem CID 115196322) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine |
| PubChem CID | 115196322 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine |
| SMILES | Cc1nc2cc(NCC(C)N)ccc2n1C |
| InChI | InChI=1S/C12H18N4/c1-8(13)7-14-10-4-5-12-11(6-10)15-9(2)16(12)3/h4-6,8,14H,7,13H2,1-3H3 |
| InChIKey | WMKZRHWDBAZIMK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine?
The IUPAC name of 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine (CID 115196322) is 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine.
What is the SMILES notation for 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine?
The canonical SMILES for 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine is Cc1nc2cc(NCC(C)N)ccc2n1C.
What is the InChIKey of 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine?
The InChIKey is WMKZRHWDBAZIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-8(13)7-14-10-4-5-12-11(6-10)15-9(2)16(12)3/h4-6,8,14H,7,13H2,1-3H3.
What are the key properties of 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine?
1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine has a molecular weight of 218.30 g/mol, XLogP of 1.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(1,2-dimethylbenzimidazol-5-yl)propane-1,2-diamine is sourced from PubChem (CID 115196322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).