C14H22N4 — CID 115203627
1-N-(1,2-dimethylbenzimidazol-5-yl)pentane-1,4-diamine (PubChem CID 115203627) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-N-(1,2-dimethylbenzimidazol-5-yl)pentane-1,4-diamine.
| Compound Name | 1-N-(1,2-dimethylbenzimidazol-5-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 115203627 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-N-(1,2-dimethylbenzimidazol-5-yl)pentane-1,4-diamine |
| SMILES | Cc1nc2cc(NCCCC(C)N)ccc2n1C |
| InChI | InChI=1S/C14H22N4/c1-10(15)5-4-8-16-12-6-7-14-13(9-12)17-11(2)18(14)3/h6-7,9-10,16H,4-5,8,15H2,1-3H3 |
| InChIKey | XTNCFLFCWHUBIF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|