About 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan
3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan (PubChem CID 11086952) has the molecular formula C10H11IO
and a molecular weight of 274.10 g/mol. Its IUPAC name is 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan.
Molecular Properties
| Compound Name | 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan |
| PubChem CID | 11086952 |
| Molecular Formula | C10H11IO |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan |
| SMILES | CC(/C=C\Cc1ccoc1)=C\I |
| InChI | InChI=1S/C10H11IO/c1-9(7-11)3-2-4-10-5-6-12-8-10/h2-3,5-8H,4H2,1H3/b3-2-,9-7+ |
| InChIKey | OLWARWXYNUWMEV-ZISRPPKGSA-N |
| XLogP | 3.72 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan?
The IUPAC name of 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan (CID 11086952) is 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan.
What is the SMILES notation for 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan?
The canonical SMILES for 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan is CC(/C=C\Cc1ccoc1)=C\I.
What is the InChIKey of 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan?
The InChIKey is OLWARWXYNUWMEV-ZISRPPKGSA-N. The full InChI is InChI=1S/C10H11IO/c1-9(7-11)3-2-4-10-5-6-12-8-10/h2-3,5-8H,4H2,1H3/b3-2-,9-7+.
What are the key properties of 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan?
3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan has a molecular weight of 274.10 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2Z,4E)-5-iodo-4-methylpenta-2,4-dienyl]furan is sourced from PubChem (CID 11086952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).