C16H14N2O2 — CID 110872276
N-[2-(1-benzofuran-3-yl)ethyl]pyridine-3-carboxamide (PubChem CID 110872276) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[2-(1-benzofuran-3-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(1-benzofuran-3-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110872276 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[2-(1-benzofuran-3-yl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1coc2ccccc12)c1cccnc1 |
| InChI | InChI=1S/C16H14N2O2/c19-16(12-4-3-8-17-10-12)18-9-7-13-11-20-15-6-2-1-5-14(13)15/h1-6,8,10-11H,7,9H2,(H,18,19) |
| InChIKey | IGJYFZPBZLARLJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |