C19H20N2O3 — CID 110873914
1-(4-methoxybenzoyl)-4-phenyl-1,4-diazepan-5-one (PubChem CID 110873914) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(4-methoxybenzoyl)-4-phenyl-1,4-diazepan-5-one.
| Compound Name | 1-(4-methoxybenzoyl)-4-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110873914 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(4-methoxybenzoyl)-4-phenyl-1,4-diazepan-5-one |
| SMILES | COc1ccc(C(=O)N2CCC(=O)N(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-24-17-9-7-15(8-10-17)19(23)20-12-11-18(22)21(14-13-20)16-5-3-2-4-6-16/h2-10H,11-14H2,1H3 |
| InChIKey | FXYCKEJYXZWZEI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |