C18H17FN2O2 — CID 110873908
1-(3-fluorobenzoyl)-4-phenyl-1,4-diazepan-5-one (PubChem CID 110873908) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 1-(3-fluorobenzoyl)-4-phenyl-1,4-diazepan-5-one.
| Compound Name | 1-(3-fluorobenzoyl)-4-phenyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 110873908 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(3-fluorobenzoyl)-4-phenyl-1,4-diazepan-5-one |
| SMILES | O=C(c1cccc(F)c1)N1CCC(=O)N(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17FN2O2/c19-15-6-4-5-14(13-15)18(23)20-10-9-17(22)21(12-11-20)16-7-2-1-3-8-16/h1-8,13H,9-12H2 |
| InChIKey | DRXSQLOXDJPWME-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |