About phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate
phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate (PubChem CID 110874085) has the molecular formula C17H17N5O2
and a molecular weight of 323.36 g/mol. Its IUPAC name is phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate |
| PubChem CID | 110874085 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCN(c2ccnc3ccnn23)CC1 |
| InChI | InChI=1S/C17H17N5O2/c23-17(24-14-4-2-1-3-5-14)21-12-10-20(11-13-21)16-7-8-18-15-6-9-19-22(15)16/h1-9H,10-13H2 |
| InChIKey | LVURYNWLVJCSMN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate?
The IUPAC name of phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate (CID 110874085) is phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate.
What is the SMILES notation for phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate?
The canonical SMILES for phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate is O=C(Oc1ccccc1)N1CCN(c2ccnc3ccnn23)CC1.
What is the InChIKey of phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate?
The InChIKey is LVURYNWLVJCSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O2/c23-17(24-14-4-2-1-3-5-14)21-12-10-20(11-13-21)16-7-8-18-15-6-9-19-22(15)16/h1-9H,10-13H2.
What are the key properties of phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate?
phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate has a molecular weight of 323.36 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-pyrazolo[1,5-a]pyrimidin-7-ylpiperazine-1-carboxylate is sourced from PubChem (CID 110874085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).