C17H19N5O2S — CID 134796696
CID 134796696 (PubChem CID 134796696) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol.
| Compound Name | CID 134796696 |
|---|---|
| PubChem CID | 134796696 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1ccccc1)N1CCCN(c2ccnc3ccnn23)CC1 |
| InChI | InChI=1S/C17H19N5O2S/c23-25(24,15-5-2-1-3-6-15)21-12-4-11-20(13-14-21)17-8-9-18-16-7-10-19-22(16)17/h1-3,5-10H,4,11-14H2 |
| InChIKey | WAKLDOXWONVSPX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|