C16H22N2O2 — CID 110874634
1-cyclohexyl-3-(3,4-dihydro-2H-chromen-8-yl)urea (PubChem CID 110874634) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dihydro-2H-chromen-8-yl)urea.
| Compound Name | 1-cyclohexyl-3-(3,4-dihydro-2H-chromen-8-yl)urea |
|---|---|
| PubChem CID | 110874634 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dihydro-2H-chromen-8-yl)urea |
| SMILES | O=C(Nc1cccc2c1OCCC2)NC1CCCCC1 |
| InChI | InChI=1S/C16H22N2O2/c19-16(17-13-8-2-1-3-9-13)18-14-10-4-6-12-7-5-11-20-15(12)14/h4,6,10,13H,1-3,5,7-9,11H2,(H2,17,18,19) |
| InChIKey | SPJRUOBQHKRBOX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |