C16H22O5 — CID 11087684
methyl (4aS,8aR)-8,8-dimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate (PubChem CID 11087684) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl (4aS,8aR)-8,8-dimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,8aR)-8,8-dimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 11087684 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | methyl (4aS,8aR)-8,8-dimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)C(OC)(OC)[C@@H]1CC(C)=C(C)C2 |
| InChI | InChI=1S/C16H22O5/c1-10-8-12-15(9-11(10)2,14(18)19-3)7-6-13(17)16(12,20-4)21-5/h6-7,12H,8-9H2,1-5H3/t12-,15-/m1/s1 |
| InChIKey | XPUXWWOJQWQMLX-IUODEOHRSA-N |
| XLogP | 2.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|