C17H24O6 — CID 101348306
methyl (4aS,8aR)-6,8,8-trimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate (PubChem CID 101348306) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is methyl (4aS,8aR)-6,8,8-trimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,8aR)-6,8,8-trimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 101348306 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl (4aS,8aR)-6,8,8-trimethoxy-2,3-dimethyl-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=C(OC)C(=O)C(OC)(OC)[C@@H]1CC(C)=C(C)C2 |
| InChI | InChI=1S/C17H24O6/c1-10-7-13-16(8-11(10)2,15(19)21-4)9-12(20-3)14(18)17(13,22-5)23-6/h9,13H,7-8H2,1-6H3/t13-,16+/m1/s1 |
| InChIKey | YXXGEPSDMVDXST-CJNGLKHVSA-N |
| XLogP | 1.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|