C18H28O7Si — CID 10872700
methyl (4aS,8aR)-6,8,8-trimethoxy-7-oxo-3-trimethylsilyloxy-4,8a-dihydro-1H-naphthalene-4a-carboxylate (PubChem CID 10872700) has the molecular formula C18H28O7Si and a molecular weight of 384.50 g/mol. Its IUPAC name is methyl (4aS,8aR)-6,8,8-trimethoxy-7-oxo-3-trimethylsilyloxy-4,8a-dihydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,8aR)-6,8,8-trimethoxy-7-oxo-3-trimethylsilyloxy-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10872700 |
| Molecular Formula | C18H28O7Si |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | methyl (4aS,8aR)-6,8,8-trimethoxy-7-oxo-3-trimethylsilyloxy-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=C(OC)C(=O)C(OC)(OC)[C@@H]1CC=C(O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C18H28O7Si/c1-21-13-11-17(16(20)22-2)10-12(25-26(5,6)7)8-9-14(17)18(23-3,24-4)15(13)19/h8,11,14H,9-10H2,1-7H3/t14-,17+/m1/s1 |
| InChIKey | HVXCFIFMVMXUTC-PBHICJAKSA-N |
| XLogP | 2.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|