C15H20O6 — CID 101348315
methyl (4aR,8aS)-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate (PubChem CID 101348315) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl (4aR,8aS)-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4aR,8aS)-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 101348315 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl (4aR,8aS)-6,8,8-trimethoxy-7-oxo-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C=C(OC)C(=O)C(OC)(OC)[C@H]1CC=CC2 |
| InChI | InChI=1S/C15H20O6/c1-18-10-9-14(13(17)19-2)8-6-5-7-11(14)15(20-3,21-4)12(10)16/h5-6,9,11H,7-8H2,1-4H3/t11-,14+/m0/s1 |
| InChIKey | WXJBFIMCMPVSMV-SMDDNHRTSA-N |
| XLogP | 1.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|