C19H22N2O — CID 11087694
(15R,19S,21S)-18-oxa-1,11-diazahexacyclo[9.8.2.115,19.02,7.08,20.015,21]docosa-2,4,6,8(20)-tetraene (PubChem CID 11087694) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (15R,19S,21S)-18-oxa-1,11-diazahexacyclo[9.8.2.115,19.02,7.08,20.015,21]docosa-2,4,6,8(20)-tetraene.
| Compound Name | (15R,19S,21S)-18-oxa-1,11-diazahexacyclo[9.8.2.115,19.02,7.08,20.015,21]docosa-2,4,6,8(20)-tetraene |
|---|---|
| PubChem CID | 11087694 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (15R,19S,21S)-18-oxa-1,11-diazahexacyclo[9.8.2.115,19.02,7.08,20.015,21]docosa-2,4,6,8(20)-tetraene |
| SMILES | c1ccc2c(c1)c1c3n2[C@@H]2C[C@@]4(CCCN(CC1)[C@H]34)CCO2 |
| InChI | InChI=1S/C19H22N2O/c1-2-5-15-13(4-1)14-6-10-20-9-3-7-19-8-11-22-16(12-19)21(15)17(14)18(19)20/h1-2,4-5,16,18H,3,6-12H2/t16-,18+,19+/m0/s1 |
| InChIKey | JWJLMBUDXBZVLW-QXAKKESOSA-N |
| XLogP | 3.64 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |