C19H20N2O — CID 71501404
(15S,16R,18S,20S)-16-methyl-17-oxa-1,11-diazahexacyclo[9.7.2.115,18.02,7.08,19.015,20]henicosa-2,4,6,8(19),13-pentaene (PubChem CID 71501404) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (15S,16R,18S,20S)-16-methyl-17-oxa-1,11-diazahexacyclo[9.7.2.115,18.02,7.08,19.015,20]henicosa-2,4,6,8(19),13-pentaene.
| Compound Name | (15S,16R,18S,20S)-16-methyl-17-oxa-1,11-diazahexacyclo[9.7.2.115,18.02,7.08,19.015,20]henicosa-2,4,6,8(19),13-pentaene |
|---|---|
| PubChem CID | 71501404 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (15S,16R,18S,20S)-16-methyl-17-oxa-1,11-diazahexacyclo[9.7.2.115,18.02,7.08,19.015,20]henicosa-2,4,6,8(19),13-pentaene |
| SMILES | C[C@H]1O[C@H]2C[C@@]13C=CCN1CCc4c(n2c2ccccc42)[C@@H]13 |
| InChI | InChI=1S/C19H20N2O/c1-12-19-8-4-9-20-10-7-14-13-5-2-3-6-15(13)21(16(11-19)22-12)17(14)18(19)20/h2-6,8,12,16,18H,7,9-11H2,1H3/t12-,16+,18-,19+/m1/s1 |
| InChIKey | FTSPQTZEHUCKSF-QUSXHRHCSA-N |
| XLogP | 3.42 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|