C20H24N2 — CID 58381647
(15R,19S)-15,17,17-trimethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),13-pentaene (PubChem CID 58381647) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is (15R,19S)-15,17,17-trimethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),13-pentaene.
| Compound Name | (15R,19S)-15,17,17-trimethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),13-pentaene |
|---|---|
| PubChem CID | 58381647 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (15R,19S)-15,17,17-trimethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18),13-pentaene |
| SMILES | CC1(C)C[C@]2(C)C=CCN3CCc4c(n1c1ccccc41)[C@@H]32 |
| InChI | InChI=1S/C20H24N2/c1-19(2)13-20(3)10-6-11-21-12-9-15-14-7-4-5-8-16(14)22(19)17(15)18(20)21/h4-8,10,18H,9,11-13H2,1-3H3/t18-,20+/m1/s1 |
| InChIKey | HEQWJEYABGOZBX-QUCCMNQESA-N |
| XLogP | 4.26 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|