C16H24FNO3 — CID 110877558
1-[(2-fluorophenyl)methoxy]-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol (PubChem CID 110877558) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methoxy]-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[(2-fluorophenyl)methoxy]-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 110877558 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-[(2-fluorophenyl)methoxy]-3-[2-(hydroxymethyl)piperidin-1-yl]propan-2-ol |
| SMILES | OCC1CCCCN1CC(O)COCc1ccccc1F |
| InChI | InChI=1S/C16H24FNO3/c17-16-7-2-1-5-13(16)11-21-12-15(20)9-18-8-4-3-6-14(18)10-19/h1-2,5,7,14-15,19-20H,3-4,6,8-12H2 |
| InChIKey | IXZIPKMRHVVHPE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |