C17H26FNO3 — CID 100837884
(2R)-1-[(2-fluorophenyl)methoxy]-3-[(3S)-3-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol (PubChem CID 100837884) has the molecular formula C17H26FNO3 and a molecular weight of 311.40 g/mol. Its IUPAC name is (2R)-1-[(2-fluorophenyl)methoxy]-3-[(3S)-3-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[(2-fluorophenyl)methoxy]-3-[(3S)-3-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 100837884 |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (2R)-1-[(2-fluorophenyl)methoxy]-3-[(3S)-3-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol |
| SMILES | OCC[C@@H]1CCCN(C[C@@H](O)COCc2ccccc2F)C1 |
| InChI | InChI=1S/C17H26FNO3/c18-17-6-2-1-5-15(17)12-22-13-16(21)11-19-8-3-4-14(10-19)7-9-20/h1-2,5-6,14,16,20-21H,3-4,7-13H2/t14-,16+/m0/s1 |
| InChIKey | UVWHUAYBJIAMKZ-GOEBONIOSA-N |
| XLogP | 1.80 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |