C16H24FNO2S — CID 124888330
(2R)-1-(2-fluorophenoxy)-3-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]propan-2-ol (PubChem CID 124888330) has the molecular formula C16H24FNO2S and a molecular weight of 313.44 g/mol. Its IUPAC name is (2R)-1-(2-fluorophenoxy)-3-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(2-fluorophenoxy)-3-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 124888330 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (2R)-1-(2-fluorophenoxy)-3-[(3S)-3-(methylsulfanylmethyl)piperidin-1-yl]propan-2-ol |
| SMILES | CSC[C@H]1CCCN(C[C@@H](O)COc2ccccc2F)C1 |
| InChI | InChI=1S/C16H24FNO2S/c1-21-12-13-5-4-8-18(9-13)10-14(19)11-20-16-7-3-2-6-15(16)17/h2-3,6-7,13-14,19H,4-5,8-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | FFLZPKMNDIKTRJ-UONOGXRCSA-N |
| XLogP | 2.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |