C19H28N2O3 — CID 110877644
4-tert-butyl-N-[2-[(4-hydroxycyclohexyl)amino]-2-oxoethyl]benzamide (PubChem CID 110877644) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[(4-hydroxycyclohexyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[(4-hydroxycyclohexyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110877644 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 4-tert-butyl-N-[2-[(4-hydroxycyclohexyl)amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(=O)NC2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2,3)14-6-4-13(5-7-14)18(24)20-12-17(23)21-15-8-10-16(22)11-9-15/h4-7,15-16,22H,8-12H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | KTUBUPOXCBTNDM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |