C16H27NO4 — CID 11087794
tert-butyl 6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11087794) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is tert-butyl 6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11087794 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | tert-butyl 6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC=CC1CC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H27NO4/c1-15(2,3)21-14(18)17-9-7-6-8-12(17)10-13-11-19-16(4,5)20-13/h6,8,12-13H,7,9-11H2,1-5H3 |
| InChIKey | VDPNHABEAUAYAL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|