C19H31NO4 — CID 102134510
tert-butyl (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,3,4,7-tetrahydroazepine-1-carboxylate (PubChem CID 102134510) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,3,4,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,3,4,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 102134510 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | tert-butyl (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,3,4,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC[C@H]([C@H]2COC3(CCCCC3)O2)C1 |
| InChI | InChI=1S/C19H31NO4/c1-18(2,3)24-17(21)20-12-8-5-9-15(13-20)16-14-22-19(23-16)10-6-4-7-11-19/h5,8,15-16H,4,6-7,9-14H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | BOVFHJXVAOTOJW-JKSUJKDBSA-N |
| XLogP | 3.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|