C16H26ClNO3 — CID 110880362
1-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol (PubChem CID 110880362) has the molecular formula C16H26ClNO3 and a molecular weight of 315.84 g/mol. Its IUPAC name is 1-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol.
| Compound Name | 1-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 110880362 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-3-[(2-methylpropan-2-yl)oxy]propan-2-ol |
| SMILES | COc1ccc(Cl)cc1CN(C)CC(O)COC(C)(C)C |
| InChI | InChI=1S/C16H26ClNO3/c1-16(2,3)21-11-14(19)10-18(4)9-12-8-13(17)6-7-15(12)20-5/h6-8,14,19H,9-11H2,1-5H3 |
| InChIKey | UKNHITMKWYWRBW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |