C16H22F2N2O2 — CID 110881770
2-[cyclohexyl(2-hydroxyethyl)amino]-N-(3,4-difluorophenyl)acetamide (PubChem CID 110881770) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 2-[cyclohexyl(2-hydroxyethyl)amino]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[cyclohexyl(2-hydroxyethyl)amino]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 110881770 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[cyclohexyl(2-hydroxyethyl)amino]-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(CN(CCO)C1CCCCC1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H22F2N2O2/c17-14-7-6-12(10-15(14)18)19-16(22)11-20(8-9-21)13-4-2-1-3-5-13/h6-7,10,13,21H,1-5,8-9,11H2,(H,19,22) |
| InChIKey | NMBSBKMPTGMNAI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |