C15H20ClFN2O2 — CID 111431998
N-(3-chloro-4-fluorophenyl)-2-[cyclopropyl(4-hydroxybutyl)amino]acetamide (PubChem CID 111431998) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[cyclopropyl(4-hydroxybutyl)amino]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[cyclopropyl(4-hydroxybutyl)amino]acetamide |
|---|---|
| PubChem CID | 111431998 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[cyclopropyl(4-hydroxybutyl)amino]acetamide |
| SMILES | O=C(CN(CCCCO)C1CC1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClFN2O2/c16-13-9-11(3-6-14(13)17)18-15(21)10-19(12-4-5-12)7-1-2-8-20/h3,6,9,12,20H,1-2,4-5,7-8,10H2,(H,18,21) |
| InChIKey | NFTSQZQHEXFYLG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|