C15H20F2N2O2 — CID 111457031
2-[cyclopropyl(4-hydroxybutyl)amino]-N-(2,4-difluorophenyl)acetamide (PubChem CID 111457031) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[cyclopropyl(4-hydroxybutyl)amino]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[cyclopropyl(4-hydroxybutyl)amino]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 111457031 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[cyclopropyl(4-hydroxybutyl)amino]-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(CN(CCCCO)C1CC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O2/c16-11-3-6-14(13(17)9-11)18-15(21)10-19(12-4-5-12)7-1-2-8-20/h3,6,9,12,20H,1-2,4-5,7-8,10H2,(H,18,21) |
| InChIKey | YLMQGNOPZSDTDG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|