C16H26N2O2 — CID 110882611
1-(2-hydroxyethyl)-3-[1-(4-methylphenyl)propyl]-1-propylurea (PubChem CID 110882611) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[1-(4-methylphenyl)propyl]-1-propylurea.
| Compound Name | 1-(2-hydroxyethyl)-3-[1-(4-methylphenyl)propyl]-1-propylurea |
|---|---|
| PubChem CID | 110882611 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[1-(4-methylphenyl)propyl]-1-propylurea |
| SMILES | CCCN(CCO)C(=O)NC(CC)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-10-18(11-12-19)16(20)17-15(5-2)14-8-6-13(3)7-9-14/h6-9,15,19H,4-5,10-12H2,1-3H3,(H,17,20) |
| InChIKey | HTUPMWIKGZDBJI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |