C13H14FN3OS — CID 110883647
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)ethanol (PubChem CID 110883647) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 110883647 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(4-fluorophenyl)ethanol |
| SMILES | Cc1cc(N)nc(SCC(O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C13H14FN3OS/c1-8-6-12(15)17-13(16-8)19-7-11(18)9-2-4-10(14)5-3-9/h2-6,11,18H,7H2,1H3,(H2,15,16,17) |
| InChIKey | BMSHVXDYGPMKJY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |