C18H20N2O2 — CID 110883825
(3-hydroxypiperidin-1-yl)-(2-methyl-6-phenyl-3-pyridinyl)methanone (PubChem CID 110883825) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-(2-methyl-6-phenyl-3-pyridinyl)methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-(2-methyl-6-phenyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 110883825 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-(2-methyl-6-phenyl-3-pyridinyl)methanone |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C18H20N2O2/c1-13-16(18(22)20-11-5-8-15(21)12-20)9-10-17(19-13)14-6-3-2-4-7-14/h2-4,6-7,9-10,15,21H,5,8,11-12H2,1H3 |
| InChIKey | NLQOVYVNXTWMLQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |