C16H18N2O2S — CID 110922130
(3-hydroxypiperidin-1-yl)-(2-methyl-6-thiophen-3-yl-3-pyridinyl)methanone (PubChem CID 110922130) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-(2-methyl-6-thiophen-3-yl-3-pyridinyl)methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-(2-methyl-6-thiophen-3-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 110922130 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-(2-methyl-6-thiophen-3-yl-3-pyridinyl)methanone |
| SMILES | Cc1nc(-c2ccsc2)ccc1C(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-14(16(20)18-7-2-3-13(19)9-18)4-5-15(17-11)12-6-8-21-10-12/h4-6,8,10,13,19H,2-3,7,9H2,1H3 |
| InChIKey | LQURAYLBIUOAIB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |