C20H22N4OS — CID 126788105
(2-methyl-6-thiophen-3-yl-3-pyridinyl)-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]methanone (PubChem CID 126788105) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is (2-methyl-6-thiophen-3-yl-3-pyridinyl)-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (2-methyl-6-thiophen-3-yl-3-pyridinyl)-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 126788105 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (2-methyl-6-thiophen-3-yl-3-pyridinyl)-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1nc(-c2ccsc2)ccc1C(=O)N1CCC(Cn2cccn2)CC1 |
| InChI | InChI=1S/C20H22N4OS/c1-15-18(3-4-19(22-15)17-7-12-26-14-17)20(25)23-10-5-16(6-11-23)13-24-9-2-8-21-24/h2-4,7-9,12,14,16H,5-6,10-11,13H2,1H3 |
| InChIKey | LFUGKUUTDZGKCA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |