C12H16N2O2S — CID 110884307
2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]butan-1-ol (PubChem CID 110884307) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]butan-1-ol.
| Compound Name | 2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 110884307 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]butan-1-ol |
| SMILES | CCC(CO)NCc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C12H16N2O2S/c1-2-9(7-15)13-6-10-8-17-12(14-10)11-4-3-5-16-11/h3-5,8-9,13,15H,2,6-7H2,1H3 |
| InChIKey | BGXDAAHUVBDZSS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |