C13H18N2O2S — CID 111449190
3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]pentan-1-ol (PubChem CID 111449190) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]pentan-1-ol.
| Compound Name | 3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 111449190 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[[2-(furan-2-yl)-1,3-thiazol-4-yl]methylamino]pentan-1-ol |
| SMILES | CCC(CCO)NCc1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C13H18N2O2S/c1-2-10(5-6-16)14-8-11-9-18-13(15-11)12-4-3-7-17-12/h3-4,7,9-10,14,16H,2,5-6,8H2,1H3 |
| InChIKey | LYUOGNLBMARROW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |