C18H19FO3 — CID 110885738
4-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]phenyl]butan-2-one (PubChem CID 110885738) has the molecular formula C18H19FO3 and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]phenyl]butan-2-one.
| Compound Name | 4-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]phenyl]butan-2-one |
|---|---|
| PubChem CID | 110885738 |
| Molecular Formula | C18H19FO3 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(OCC(O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C18H19FO3/c1-13(20)6-7-14-8-10-15(11-9-14)22-12-18(21)16-4-2-3-5-17(16)19/h2-5,8-11,18,21H,6-7,12H2,1H3 |
| InChIKey | HNTJZBLPGXWSFZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |