C17H21N3O3 — CID 110886514
N-benzyl-N-(2-hydroxyethyl)-6-oxo-1-propylpyridazine-3-carboxamide (PubChem CID 110886514) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-6-oxo-1-propylpyridazine-3-carboxamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-6-oxo-1-propylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 110886514 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-6-oxo-1-propylpyridazine-3-carboxamide |
| SMILES | CCCn1nc(C(=O)N(CCO)Cc2ccccc2)ccc1=O |
| InChI | InChI=1S/C17H21N3O3/c1-2-10-20-16(22)9-8-15(18-20)17(23)19(11-12-21)13-14-6-4-3-5-7-14/h3-9,21H,2,10-13H2,1H3 |
| InChIKey | OOTACMDUJBTZRR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |