C16H20N2O4 — CID 110887129
N-(2-hydroxyethyl)-5-[(2-oxo-1-pyridinyl)methyl]-N-propylfuran-2-carboxamide (PubChem CID 110887129) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-5-[(2-oxo-1-pyridinyl)methyl]-N-propylfuran-2-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-5-[(2-oxo-1-pyridinyl)methyl]-N-propylfuran-2-carboxamide |
|---|---|
| PubChem CID | 110887129 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(2-hydroxyethyl)-5-[(2-oxo-1-pyridinyl)methyl]-N-propylfuran-2-carboxamide |
| SMILES | CCCN(CCO)C(=O)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C16H20N2O4/c1-2-8-17(10-11-19)16(21)14-7-6-13(22-14)12-18-9-4-3-5-15(18)20/h3-7,9,19H,2,8,10-12H2,1H3 |
| InChIKey | KZPAXJNNHFXKOX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |