C22H20F3N3O4 — CID 134024450
5-[(2-oxo-1-pyridinyl)methyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylfuran-2-carboxamide (PubChem CID 134024450) has the molecular formula C22H20F3N3O4 and a molecular weight of 447.41 g/mol. Its IUPAC name is 5-[(2-oxo-1-pyridinyl)methyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylfuran-2-carboxamide.
| Compound Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylfuran-2-carboxamide |
|---|---|
| PubChem CID | 134024450 |
| Molecular Formula | C22H20F3N3O4 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 5-[(2-oxo-1-pyridinyl)methyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-N-propylfuran-2-carboxamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C22H20F3N3O4/c1-2-10-28(13-18(29)26-16-8-7-15(23)20(24)21(16)25)22(31)17-9-6-14(32-17)12-27-11-4-3-5-19(27)30/h3-9,11H,2,10,12-13H2,1H3,(H,26,29) |
| InChIKey | DSVMPXUMAONOLZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|