C14H16FNO2 — CID 110888245
2-[(3-fluoro-4-methylphenyl)methylamino]-1-(furan-2-yl)ethanol (PubChem CID 110888245) has the molecular formula C14H16FNO2 and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methylphenyl)methylamino]-1-(furan-2-yl)ethanol.
| Compound Name | 2-[(3-fluoro-4-methylphenyl)methylamino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 110888245 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-[(3-fluoro-4-methylphenyl)methylamino]-1-(furan-2-yl)ethanol |
| SMILES | Cc1ccc(CNCC(O)c2ccco2)cc1F |
| InChI | InChI=1S/C14H16FNO2/c1-10-4-5-11(7-12(10)15)8-16-9-13(17)14-3-2-6-18-14/h2-7,13,16-17H,8-9H2,1H3 |
| InChIKey | WFNQHJKFRMSLOB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |