C17H18F3NO2 — CID 110902096
1-[4-(difluoromethoxy)phenyl]-2-[(3-fluoro-4-methylphenyl)methylamino]ethanol (PubChem CID 110902096) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-[(3-fluoro-4-methylphenyl)methylamino]ethanol.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-[(3-fluoro-4-methylphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 110902096 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-[(3-fluoro-4-methylphenyl)methylamino]ethanol |
| SMILES | Cc1ccc(CNCC(O)c2ccc(OC(F)F)cc2)cc1F |
| InChI | InChI=1S/C17H18F3NO2/c1-11-2-3-12(8-15(11)18)9-21-10-16(22)13-4-6-14(7-5-13)23-17(19)20/h2-8,16-17,21-22H,9-10H2,1H3 |
| InChIKey | XCGWRYJDAJHFBX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |